* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GIT 27 |
CAS: | 6501-72-0 |
English Synonyms: | GIT 27 |
MDL Number.: | MFCD08696167 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1ccc(cc1)C2=NOC(C2)CC(=O)O |
InChi: | InChI=1S/C11H11NO3/c13-11(14)7-9-6-10(12-15-9)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,13,14) |
InChiKey: | InChIKey=MUFJHYRCIHHATF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.