* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | JYL-827 |
| CAS: | 401572-96-1 |
| English Synonyms: | JYL-827 |
| MDL Number.: | MFCD08702716 |
| H bond acceptor: | 7 |
| H bond donor: | 3 |
| Smile: | Cc1ccc(cc1C)CC(CNC(=S)NCc2ccc(cc2)NS(=O)(=O)C)COC(=O)C(C)(C)C |
| InChi: | InChI=1S/C26H37N3O4S2/c1-18-7-8-21(13-19(18)2)14-22(17-33-24(30)26(3,4)5)16-28-25(34)27-15-20-9-11-23(12-10-20)29-35(6,31)32/h7-13,22,29H,14-17H2,1-6H3,(H2,27,28,34) |
| InChiKey: | InChIKey=BYFLNNAMRBCAOL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.