* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GLUCOIMIDAZOLE HCL |
| English Synonyms: | GLUCOIMIDAZOLE HCL |
| MDL Number.: | MFCD08703207 |
| H bond acceptor: | 6 |
| H bond donor: | 4 |
| Smile: | c1cn2c(n1)[C@@H]([C@H]([C@@H]([C@H]2CO)O)O)O.Cl |
| InChi: | InChI=1S/C8H12N2O4.ClH/c11-3-4-5(12)6(13)7(14)8-9-1-2-10(4)8;/h1-2,4-7,11-14H,3H2;1H/t4-,5-,6+,7-;/m1./s1 |
| InChiKey: | InChIKey=BAWBVXDHFAJMBW-FCWDRERSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.