* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,8-DIHYDRO-8,8-DIMETHYLPYRANO[2,3]QUINOLIN-2-ONE |
| CAS: | 200814-17-1 |
| English Synonyms: | 1,8-DIHYDRO-8,8-DIMETHYLPYRANO[2,3]QUINOLIN-2-ONE |
| MDL Number.: | MFCD09028016 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC1(C=Cc2c(ccc3c2[nH]c(=O)cc3)O1)C |
| InChi: | InChI=1S/C14H13NO2/c1-14(2)8-7-10-11(17-14)5-3-9-4-6-12(16)15-13(9)10/h3-8H,1-2H3,(H,15,16) |
| InChiKey: | InChIKey=KRWYXVGRIHXUHX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.