* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | RETINOL ACETATE |
CAS: | 127-47-9 |
English Synonyms: | RETINOL ACETATE |
MDL Number.: | MFCD09028043 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CC1=C(C(CCC1)(C)C)/C=C/C(=C\C=C\C(=C/COC(=O)C)\C)/C |
InChi: | InChI=1S/C22H32O2/c1-17(9-7-10-18(2)14-16-24-20(4)23)12-13-21-19(3)11-8-15-22(21,5)6/h7,9-10,12-14H,8,11,15-16H2,1-6H3/b10-7+,13-12+,17-9-,18-14- |
InChiKey: | InChIKey=QGNJRVVDBSJHIZ-VEKRBDQFSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.