* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | PEGANINE |
CAS: | 6159-55-3 |
English Synonyms: | PEGANINE |
MDL Number.: | MFCD09028068 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1ccc2c(c1)CN3CC[C@@H](C3=N2)O |
InChi: | InChI=1S/C11H12N2O/c14-10-5-6-13-7-8-3-1-2-4-9(8)12-11(10)13/h1-4,10,14H,5-7H2/t10-/m0/s1 |
InChiKey: | InChIKey=YIICVSCAKJMMDJ-JTQLQIEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.