* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-NITRO-5,6-DIHYDRO-4H-IMIDAZO[1,2-D]TETRAZOLE |
| CAS: | 117039-77-7 |
| English Synonyms: | 4-NITRO-4H,5H,6H-IMIDAZO[1,2-D][1,2,3,4]TETRAZOLE ; 4-NITRO-5,6-DIHYDRO-4H-IMIDAZO[1,2-D]TETRAZOLE |
| MDL Number.: | MFCD09032458 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | C1CN(c2n1nnn2)[N+](=O)[O-] |
| InChi: | InChI=1S/C3H4N6O2/c10-9(11)8-2-1-7-3(8)4-5-6-7/h1-2H2 |
| InChiKey: | InChIKey=FRPKRTDWHLMWOU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.