* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 6-AZASPIRO[4.5]DECAN-9-ONE |
CAS: | 362053-34-7 |
English Synonyms: | 6-AZASPIRO[4.5]DECAN-9-ONE |
MDL Number.: | MFCD09035902 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | C1CCC2(C1)CC(=O)CCN2 |
InChi: | InChI=1S/C9H15NO/c11-8-3-6-10-9(7-8)4-1-2-5-9/h10H,1-7H2 |
InChiKey: | InChIKey=SVLAENMLBDXUTP-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.