* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOPROPYL-(R)-LACTATE |
CAS: | 63697-00-7 |
English Synonyms: | ISOPROPYL-(R)-LACTATE |
MDL Number.: | MFCD09037382 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | CC(C)OC(=O)[C@@H](C)O |
InChi: | InChI=1S/C6H12O3/c1-4(2)9-6(8)5(3)7/h4-5,7H,1-3H3/t5-/m1/s1 |
InChiKey: | InChIKey=KIWATKANDHUUOB-RXMQYKEDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.