* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3,4-DIBROMO-2-FLUOROPYRIDINE |
CAS: | 137718-84-4 |
English Synonyms: | 3,4-DIBROMO-2-FLUOROPYRIDINE |
MDL Number.: | MFCD09037460 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cnc(c(c1Br)Br)F |
InChi: | InChI=1S/C5H2Br2FN/c6-3-1-2-9-5(8)4(3)7/h1-2H |
InChiKey: | InChIKey=RALUGCFMNLTFAK-UHFFFAOYSA-N |
|
|
Melting Point: | 74-77 DEG C |
Comments: | HARMFUL/IRRITANT HAZARD: R 20/21/22-36/37/38 HAZARD: S 26-36/37 TSCA: N UN NUMBER: UN2811 UNSPSC: 12352005 |
|
* If the product has intellectual property rights, a license granted is must or contact us.