* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | 3-FLUORO-2,2',4,4',6-PENTABROMODIPHENYL ETHER |
CAS: | 887401-80-1 |
English Synonyms: | F-PBDE-100 ; 3-FLUORO-2,2',4,4',6-PENTABROMODIPHENYL ETHER |
MDL Number.: | MFCD09037625 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(c(cc1Br)Br)Oc2c(cc(c(c2Br)F)Br)Br |
InChi: | InChI=1S/C12H4Br5FO/c13-5-1-2-9(6(14)3-5)19-12-8(16)4-7(15)11(18)10(12)17/h1-4H |
InChiKey: | InChIKey=RQWOMWHCPDRRFC-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.