* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-IODO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE |
| CAS: | 690258-25-4 |
| English Synonyms: | 7-IODO-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE ; [1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 7-IODO- |
| MDL Number.: | MFCD09038164 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cn2c(cc1I)ncn2 |
| InChi: | InChI=1S/C6H4IN3/c7-5-1-2-10-6(3-5)8-4-9-10/h1-4H |
| InChiKey: | InChIKey=RHSZXENOJXHZSD-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.