* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GAMMACERANE |
CAS: | 559-65-9 |
English Synonyms: | GAMMACERANE ; G |
MDL Number.: | MFCD09038295 |
H bond acceptor: | 0 |
H bond donor: | 0 |
Smile: | CC1(CCC[C@]2([C@H]1CC[C@@]3([C@@H]2CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CCCC5(C)C)C)C)C)C)C |
InChi: | InChI=1S/C30H52/c1-25(2)15-9-17-27(5)21(25)13-19-29(7)23(27)11-12-24-28(6)18-10-16-26(3,4)22(28)14-20-30(24,29)8/h21-24H,9-20H2,1-8H3/t21-,22-,23+,24+,27-,28-,29+,30+/m0/s1 |
InChiKey: | InChIKey=QDUDLLAGYKHBNK-QPYQYMOUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.