* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BURIMAMIDE OXALATE |
| CAS: | 34970-69-9 |
| English Synonyms: | BURIMAMIDE OXALATE |
| MDL Number.: | MFCD09038550 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | CNC(=S)NCCCCc1c[nH]cn1.C(=O)(C(=O)O)O |
| InChi: | InChI=1S/C9H16N4S.C2H2O4/c1-10-9(14)12-5-3-2-4-8-6-11-7-13-8;3-1(4)2(5)6/h6-7H,2-5H2,1H3,(H,11,13)(H2,10,12,14);(H,3,4)(H,5,6) |
| InChiKey: | InChIKey=MEZGTBOTWIZWEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.