* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | GERANIIN |
| CAS: | 60976-49-0 |
| English Synonyms: | GERANIIN |
| MDL Number.: | MFCD09038731 |
| H bond acceptor: | 27 |
| H bond donor: | 14 |
| Smile: | c1c(cc(c(c1O)O)O)C(=O)O[C@H]2[C@H]3[C@@H]4[C@@H]([C@H](O2)COC(=O)c5cc(c(c(c5-c6c(cc(c(c6O)O)O)C(=O)O4)O)O)O)OC(=O)C7=CC(=O)[C@]8(C([C@@H]7c9c(cc(c(c9O8)O)O)C(=O)O3)(O)O)O |
| InChi: | InChI=1S/C41H28O27/c42-13-1-8(2-14(43)24(13)48)34(54)67-39-33-32-30(64-38(58)12-6-19(47)41(61)40(59,60)23(12)22-11(37(57)66-33)5-17(46)27(51)31(22)68-41)18(63-39)7-62-35(55)9-3-15(44)25(49)28(52)20(9)21-10(36(56)65-32)4-16(45)26(50)29(21)53/h1-6,18,23,30,32-33,39,42-46,48-53,59-61H,7H2/t18-,23+,30-,32+,33-,39+,41+/m1/s1 |
| InChiKey: | InChIKey=JQQBXPCJFAKSPG-SVYIMCMUSA-N |
|
|
| Comments: | ASSAY BY HPLC |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.