* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 2-(1-AMINOETHYL)PHENOL |
| CAS: | 89985-53-5 |
| English Synonyms: | 2-(AMINOETHYL)PHENOL ; 2-(1-AMINOETHYL)PHENOL |
| MDL Number.: | MFCD09050109 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | CC(c1ccccc1O)N |
| InChi: | InChI=1S/C8H11NO/c1-6(9)7-4-2-3-5-8(7)10/h2-6,10H,9H2,1H3 |
| InChiKey: | InChIKey=ZWKWKJWRIYGQFD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.