* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| CAS: | 501357-89-7 |
| English Synonyms: | 8-CHLORO-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| MDL Number.: | MFCD09258641 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(c2nncn2c1)Cl |
| InChi: | InChI=1S/C6H4ClN3/c7-5-2-1-3-10-4-8-9-6(5)10/h1-4H |
| InChiKey: | InChIKey=OOHXKDTZOJELHU-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.