* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-BROMO-5-CHLORO-1H-INDAZOLE |
| CAS: | 875305-86-5 |
| English Synonyms: | INDAZOLE, 7-BROMO-5-CHLORO- ; 7-BROMO-5-CHLORO-1H-INDAZOLE |
| MDL Number.: | MFCD09258643 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1c(cc(c2c1cn[nH]2)Br)Cl |
| InChi: | InChI=1S/C7H4BrClN2/c8-6-2-5(9)1-4-3-10-11-7(4)6/h1-3H,(H,10,11) |
| InChiKey: | InChIKey=CTXAUTRSBNWONT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.