* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-CHLORO-3-METHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| CAS: | 929000-42-0 |
| English Synonyms: | 8-CHLORO-3-METHYL-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| MDL Number.: | MFCD09258771 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cc1nnc2n1cccc2Cl |
| InChi: | InChI=1S/C7H6ClN3/c1-5-9-10-7-6(8)3-2-4-11(5)7/h2-4H,1H3 |
| InChiKey: | InChIKey=IYHIDEHLMBFMAW-UHFFFAOYSA-N |
|
|
| Comments: | WARNINGS: IRRITANT |
|
|
* If the product has intellectual property rights, a license granted is must or contact us.