* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 6-METHYL-8-NITRO-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| CAS: | 929000-70-4 |
| English Synonyms: | 6-METHYL-8-NITRO-[1,2,4]TRIAZOLO[4,3-A]PYRIDINE |
| MDL Number.: | MFCD09258779 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | Cc1cc(c2nncn2c1)[N+](=O)[O-] |
| InChi: | InChI=1S/C7H6N4O2/c1-5-2-6(11(12)13)7-9-8-4-10(7)3-5/h2-4H,1H3 |
| InChiKey: | InChIKey=XNJFZJNTYXYHCP-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.