* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 1,7-DIAZA-SPIRO[4.5]DECANE |
| CAS: | 88619-21-0 |
| English Synonyms: | 1,7-DIAZA-SPIRO[4.5]DECANE |
| MDL Number.: | MFCD09260616 |
| H bond acceptor: | 2 |
| H bond donor: | 2 |
| Smile: | C1CC2(CCCN2)CNC1 |
| InChi: | InChI=1S/C8H16N2/c1-3-8(7-9-5-1)4-2-6-10-8/h9-10H,1-7H2 |
| InChiKey: | InChIKey=RHRMCNWRSJMIFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.