* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UV-ABSORBENT TRIAZINE-5 |
| CAS: | 63856-18-8 |
| English Synonyms: | UV-ABSORBENT TRIAZINE-5 |
| MDL Number.: | MFCD09263705 |
| H bond acceptor: | 12 |
| H bond donor: | 0 |
| Smile: | COC(=O)CC(c1ccccc1)n2c(=O)n(c(=O)n(c2=O)C(CC(=O)OC)c3ccccc3)C(CC(=O)OC)c4ccccc4 |
| InChi: | InChI=1S/C33H33N3O9/c1-43-28(37)19-25(22-13-7-4-8-14-22)34-31(40)35(26(20-29(38)44-2)23-15-9-5-10-16-23)33(42)36(32(34)41)27(21-30(39)45-3)24-17-11-6-12-18-24/h4-18,25-27H,19-21H2,1-3H3 |
| InChiKey: | InChIKey=YRDFDZWXSXKOLH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.