* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CEFEPIME SULFATE |
| CAS: | 107648-78-2 |
| English Synonyms: | CEFEPIME SULFATE |
| MDL Number.: | MFCD09264315 |
| H bond acceptor: | 11 |
| H bond donor: | 3 |
| Smile: | C[N+]1(CCCC1)CC2=C(N3[C@@H]([C@@H](C3=O)NC(=O)/C(=N\OC)/c4csc(n4)N)SC2)C(=O)O.OS(=O)(=O)[O-] |
| InChi: | InChI=1S/C19H24N6O5S2.H2O4S/c1-25(5-3-4-6-25)7-10-8-31-17-13(16(27)24(17)14(10)18(28)29)22-15(26)12(23-30-2)11-9-32-19(20)21-11;1-5(2,3)4/h9,13,17H,3-8H2,1-2H3,(H3-,20,21,22,26,28,29);(H2,1,2,3,4)/b23-12-;/t13-,17-;/m1./s1 |
| InChiKey: | InChIKey=JCRAHWHSZYCYEI-LSGRDSQZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.