* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-FLUORO-L-TRYPTOPHAN |
| CAS: | 138514-97-3 |
| English Synonyms: | L-TRYPTOPHAN, 7-FLUORO- ; 7-FLUORO-L-TRYPTOPHAN ; ABLOCK AB-11-4023 |
| MDL Number.: | MFCD09264337 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cc2c(c[nH]c2c(c1)F)C[C@@H](C(=O)O)N |
| InChi: | InChI=1S/C11H11FN2O2/c12-8-3-1-2-7-6(5-14-10(7)8)4-9(13)11(15)16/h1-3,5,9,14H,4,13H2,(H,15,16)/t9-/m0/s1 |
| InChiKey: | InChIKey=ADMHYWIKJSPIGJ-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.