* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3,5-DIBROMO-1-METHYL-1H-1,2,4-TRIAZOLE |
| CAS: | 23579-79-5 |
| English Synonyms: | 1H-1,2,4-TRIAZOLE, 3,5-DIBROMO-1-METHYL- ; 3,5-DIBROMO-1-METHYL-1H-1,2,4-TRIAZOLE ; 3,5-DIBROMO-1-METHYL-1,2,4-TRIAZOLE |
| MDL Number.: | MFCD09426402 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | Cn1c(nc(n1)Br)Br |
| InChi: | InChI=1S/C3H3Br2N3/c1-8-3(5)6-2(4)7-8/h1H3 |
| InChiKey: | InChIKey=OAPQSGTTZLYWJB-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.