* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHYL-4-PHENYL-2-(4-PHENYLPIPERAZIN-1-YL)-1H-PYRIMIDO[1,2-A][1,3,5]TRIAZIN-6(4H)-ONE |
| English Synonyms: | 8-METHYL-4-PHENYL-2-(4-PHENYLPIPERAZIN-1-YL)-1H-PYRIMIDO[1,2-A][1,3,5]TRIAZIN-6(4H)-ONE |
| MDL Number.: | MFCD09430389 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | Cc1cc(=O)n2c(n1)NC(=NC2c3ccccc3)N4CCN(CC4)c5ccccc5 |
| InChi: | InChI=1S/C23H24N6O/c1-17-16-20(30)29-21(18-8-4-2-5-9-18)25-22(26-23(29)24-17)28-14-12-27(13-15-28)19-10-6-3-7-11-19/h2-11,16,21H,12-15H2,1H3,(H,24,25,26) |
| InChiKey: | InChIKey=FZDGHMNUJMUHRI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.