* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-6-METHYLQUINOLINE |
| CAS: | 84839-95-2 |
| English Synonyms: | 8-BROMO-6-METHYLQUINOLINE |
| MDL Number.: | MFCD09701455 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | Cc1cc2cccnc2c(c1)Br |
| InChi: | InChI=1S/C10H8BrN/c1-7-5-8-3-2-4-12-10(8)9(11)6-7/h2-6H,1H3 |
| InChiKey: | InChIKey=ONJNEQXRWAWITH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.