* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4,7-DICHLOROPTERIDINE |
| CAS: | 826-89-1 |
| English Synonyms: | 4,7-DICHLOROPTERIDINE |
| MDL Number.: | MFCD09702035 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | c1c(nc2c(n1)c(ncn2)Cl)Cl |
| InChi: | InChI=1S/C6H2Cl2N4/c7-3-1-9-4-5(8)10-2-11-6(4)12-3/h1-2H |
| InChiKey: | InChIKey=GLMLCKFRCXFITK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.