* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-METHOXY-5-PHENYL[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL |
| English Synonyms: | 8-METHOXY-5-PHENYL[1,2,4]TRIAZOLO[4,3-A]QUINOLINE-1-THIOL |
| MDL Number.: | MFCD09702312 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | COc1ccc2c(cc3nnc(n3c2c1)S)c4ccccc4 |
| InChi: | InChI=1S/C17H13N3OS/c1-21-12-7-8-13-14(11-5-3-2-4-6-11)10-16-18-19-17(22)20(16)15(13)9-12/h2-10H,1H3,(H,19,22) |
| InChiKey: | InChIKey=VXUXCFHIUTZZFI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.