* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | (1-(PYRIDIN-2-YL)-1H-PYRAZOL-4-YL)METHANAMINE |
| CAS: | 1017666-73-7 |
| English Synonyms: | (1-(PYRIDIN-2-YL)-1H-PYRAZOL-4-YL)METHANAMINE |
| MDL Number.: | MFCD09703163 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | c1ccnc(c1)n2cc(cn2)CN |
| InChi: | InChI=1S/C9H10N4/c10-5-8-6-12-13(7-8)9-3-1-2-4-11-9/h1-4,6-7H,5,10H2 |
| InChiKey: | InChIKey=QKZZFQJSZLHAEH-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.