* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(2,2,2-TRIFLUOROETHOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| English Synonyms: | 8-(2,2,2-TRIFLUOROETHOXY)-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD09728624 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | c1cc2c(c(c1)OCC(F)(F)F)NCCC2 |
| InChi: | InChI=1S/C11H12F3NO/c12-11(13,14)7-16-9-5-1-3-8-4-2-6-15-10(8)9/h1,3,5,15H,2,4,6-7H2 |
| InChiKey: | InChIKey=OBOHOSVPTKJNOV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.