* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-(CHLOROMETHYL)-1,3,7-TRIMETHYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE |
| English Synonyms: | 8-(CHLOROMETHYL)-1,3,7-TRIMETHYL-2,3,6,7-TETRAHYDRO-1H-PURINE-2,6-DIONE |
| MDL Number.: | MFCD09729917 |
| H bond acceptor: | 6 |
| H bond donor: | 0 |
| Smile: | Cn1c(nc2c1c(=O)n(c(=O)n2C)C)CCl |
| InChi: | InChI=1S/C9H11ClN4O2/c1-12-5(4-10)11-7-6(12)8(15)14(3)9(16)13(7)2/h4H2,1-3H3 |
| InChiKey: | InChIKey=NIOHYEZSDIUTSQ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.