* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 8-BROMO-6-METHYL-1,2,3,4-TETRAHYDROQUINOLINE |
| English Synonyms: | 8-BROMO-6-METHYL-1,2,3,4-TETRAHYDROQUINOLINE |
| MDL Number.: | MFCD09731595 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | Cc1cc2c(c(c1)Br)NCCC2 |
| InChi: | InChI=1S/C10H12BrN/c1-7-5-8-3-2-4-12-10(8)9(11)6-7/h5-6,12H,2-4H2,1H3 |
| InChiKey: | InChIKey=AUNCOHLGLUAIAU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.