* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | NICOTELLINE |
| CAS: | 494-04-2 |
| English Synonyms: | 2,4-DI(PYRIDIN-3-YL)PYRIDINE ; 3,2':4',3''-TERPYRIDINE ; NICOTELLINE ; [3,2':4',3''']-TERPYRIDINE |
| MDL Number.: | MFCD09743383 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1cc(cnc1)c2ccnc(c2)c3cccnc3 |
| InChi: | InChI=1S/C15H11N3/c1-3-13(10-16-6-1)12-5-8-18-15(9-12)14-4-2-7-17-11-14/h1-11H |
| InChiKey: | InChIKey=OILSPHJMIPYURT-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.