* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | IMIDAZO[1,2-A]INDOL-9-ONE |
| CAS: | 120614-25-7 |
| English Synonyms: | IMIDAZO[1,2-A]INDOL-9-ONE ; 9H-IMIDAZO[1,2-A]INDOL-9-ONE |
| MDL Number.: | MFCD09743545 |
| H bond acceptor: | 3 |
| H bond donor: | 0 |
| Smile: | c1ccc-2c(c1)C(=O)c3n2ccn3 |
| InChi: | InChI=1S/C10H6N2O/c13-9-7-3-1-2-4-8(7)12-6-5-11-10(9)12/h1-6H |
| InChiKey: | InChIKey=YUUIFKILPCDCMO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.