* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 2,5-PIPERIDINEDIONE |
CAS: | 52065-78-8 |
English Synonyms: | 2,5-PIPERIDINEDIONE ; PIPERIDINE-2,5-DIONE |
MDL Number.: | MFCD09743646 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | C1CC(=O)NCC1=O |
InChi: | InChI=1S/C5H7NO2/c7-4-1-2-5(8)6-3-4/h1-3H2,(H,6,8) |
InChiKey: | InChIKey=ICZVBOAABXHPSZ-UHFFFAOYSA-N |
Property |
|
Safety information |
* If the product has intellectual property rights, a license granted is must or contact us.