* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 3-IMINO-2-INDOLINONE |
| CAS: | 612-53-3 |
| English Synonyms: | 3-IMINO-2-INDOLINONE ; 3-IMINO-2,3-DIHYDRO-1H-INDOL-2-ONE |
| MDL Number.: | MFCD09743877 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | c1ccc2c(c1)C(=N)C(=O)N2 |
| InChi: | InChI=1S/C8H6N2O/c9-7-5-3-1-2-4-6(5)10-8(7)11/h1-4H,(H2,9,10,11) |
| InChiKey: | InChIKey=DPUCWQUWEJBKPK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.