* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 4-CHLORO-6-IODOTHIENO[3,2-D]PYRIMIDINE |
| CAS: | 225382-62-7 |
| English Synonyms: | 4-CHLORO-6-IODOTHIENO[3,2-D]PYRIMIDINE |
| MDL Number.: | MFCD09746329 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | c1c2c(c(ncn2)Cl)sc1I |
| InChi: | InChI=1S/C6H2ClIN2S/c7-6-5-3(9-2-10-6)1-4(8)11-5/h1-2H |
| InChiKey: | InChIKey=HLXTYHBQAVCTSJ-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.