* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | UREA HYDROCHLORIDE |
| CAS: | 506-89-8 |
| English Synonyms: | UREA HYDROCHLORIDE |
| MDL Number.: | MFCD09749885 |
| H bond acceptor: | 3 |
| H bond donor: | 2 |
| Smile: | C(=O)(N)N.Cl |
| InChi: | InChI=1S/CH4N2O.ClH/c2-1(3)4;/h(H4,2,3,4);1H |
| InChiKey: | InChIKey=VYWQTJWGWLKBQA-UHFFFAOYSA-N |
|
|
|
|
* If the product has intellectual property rights, a license granted is must or contact us.