* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 7-FLUORO-2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE |
| CAS: | 324558-64-7 |
| English Synonyms: | 7-FLUORO-2,3,4,5-TETRAHYDRO-1H-3-BENZAZEPINE ; 1H-3-BENZAZEPINE,7-FLUORO-2,3,4,5-TETRAHYDRO- |
| MDL Number.: | MFCD09751553 |
| H bond acceptor: | 1 |
| H bond donor: | 1 |
| Smile: | c1cc2c(cc1F)CCNCC2 |
| InChi: | InChI=1S/C10H12FN/c11-10-2-1-8-3-5-12-6-4-9(8)7-10/h1-2,7,12H,3-6H2 |
| InChiKey: | InChIKey=SHDMCTOVONAMKO-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.