* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OLEAN-12-ENO[2,3-C][1,2,5]OXADIAZOL-28-OIC ACID |
| CAS: | 130216-69-2 |
| English Synonyms: | OLEAN-12-ENO[2,3-C][1,2,5]OXADIAZOL-28-OIC ACID |
| MDL Number.: | MFCD09752461 |
| H bond acceptor: | 5 |
| H bond donor: | 1 |
| Smile: | CC1(CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(Cc6c(non6)C5(C)C)C)C)[C@@H]2C1)C)C(=O)O)C |
| InChi: | InChI=1S/C30H44N2O3/c1-25(2)12-14-30(24(33)34)15-13-28(6)18(19(30)16-25)8-9-22-27(5)17-20-23(32-35-31-20)26(3,4)21(27)10-11-29(22,28)7/h8,19,21-22H,9-17H2,1-7H3,(H,33,34)/t19-,21-,22+,27-,28+,29+,30-/m0/s1 |
| InChiKey: | InChIKey=PVMMAUQTRBJOMP-QRARIYCASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.