* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | CURVULARIN |
CAS: | 10140-70-2 |
English Synonyms: | (-)-CURVULARIN ; CURVULARIN |
MDL Number.: | MFCD09752718 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | C[C@H]1CCCCCC(=O)c2c(cc(cc2O)O)CC(=O)O1 |
InChi: | InChI=1S/C16H20O5/c1-10-5-3-2-4-6-13(18)16-11(8-15(20)21-10)7-12(17)9-14(16)19/h7,9-10,17,19H,2-6,8H2,1H3/t10-/m0/s1 |
InChiKey: | InChIKey=VDUIGYAPSXCJFC-JTQLQIEISA-N |
* If the product has intellectual property rights, a license granted is must or contact us.