* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | GLUCOCHEIROLIN |
CAS: | 15592-36-6 |
English Synonyms: | GLUCOCHEIROLIN |
MDL Number.: | MFCD09752806 |
H bond acceptor: | 12 |
H bond donor: | 4 |
Smile: | CS(=O)(=O)CCC/C(=N\OS(=O)(=O)[O-])/S[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O.[K+] |
InChi: | InChI=1S/C11H21NO11S3.K/c1-25(17,18)4-2-3-7(12-23-26(19,20)21)24-11-10(16)9(15)8(14)6(5-13)22-11;/h6,8-11,13-16H,2-5H2,1H3,(H,19,20,21);/q;+1/p-1/b12-7+;/t6-,8-,9+,10-,11+;/m1./s1 |
InChiKey: | InChIKey=VANCNMMZVVUJJN-YMDACDOVSA-M |
* If the product has intellectual property rights, a license granted is must or contact us.