* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ISOBERGAPTOL |
CAS: | 21339-45-7 |
English Synonyms: | ISOBERGAPTOL |
MDL Number.: | MFCD09752951 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | c1cc(=O)oc2c1c(cc3c2cco3)O |
InChi: | InChI=1S/C11H6O4/c12-8-5-9-7(3-4-14-9)11-6(8)1-2-10(13)15-11/h1-5,12H |
InChiKey: | InChIKey=OOWBIFOFDYBTAE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.