* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURO[3,2-C]PYRIDIN-4-AMINE |
CAS: | 33007-09-9 |
English Synonyms: | FURO[3,2-C]PYRIDIN-4-YLAMINE ; FURO[3,2-C]PYRIDIN-4-AMINE |
MDL Number.: | MFCD09834943 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnc(c2c1occ2)N |
InChi: | InChI=1S/C7H6N2O/c8-7-5-2-4-10-6(5)1-3-9-7/h1-4H,(H2,8,9) |
InChiKey: | InChIKey=IWMQAUYDCYPLFK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.