* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | FURO[2,3-C]PYRIDIN-7-OL |
CAS: | 84400-98-6 |
English Synonyms: | FURO[2,3-C]PYRIDIN-7-OL |
MDL Number.: | MFCD09834946 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | c1cnc(c2c1cco2)O |
InChi: | InChI=1S/C7H5NO2/c9-7-6-5(1-3-8-7)2-4-10-6/h1-4H,(H,8,9) |
InChiKey: | InChIKey=SHSNAKRNZGOTJL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.