* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | XALIPRODEN |
| CAS: | 135354-02-8 |
| English Synonyms: | XALIPRODEN |
| MDL Number.: | MFCD09837675 |
| H bond acceptor: | 1 |
| H bond donor: | 0 |
| Smile: | c1ccc2cc(ccc2c1)CCN3CCC(=CC3)c4cccc(c4)C(F)(F)F |
| InChi: | InChI=1S/C24H22F3N/c25-24(26,27)23-7-3-6-22(17-23)20-11-14-28(15-12-20)13-10-18-8-9-19-4-1-2-5-21(19)16-18/h1-9,11,16-17H,10,12-15H2 |
| InChiKey: | InChIKey=WJJYZXPHLSLMGE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.