* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 45204 |
CAS: | 152883-32-4 |
English Synonyms: | WIN 45204 |
MDL Number.: | MFCD09837715 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | C[C@]12Cc3cn[nH]c3C=C1CC[C@H]4C2=CCC5(O4)C(=O)c6ccccc6C5=O |
InChi: | InChI=1S/C23H20N2O3/c1-22-11-13-12-24-25-18(13)10-14(22)6-7-19-17(22)8-9-23(28-19)20(26)15-4-2-3-5-16(15)21(23)27/h2-5,8,10,12,19H,6-7,9,11H2,1H3,(H,24,25)/t19-,22-/m0/s1 |
InChiKey: | InChIKey=RNXVLYSGKKOASI-UGKGYDQZSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.