* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | WIN 46834 |
CAS: | 152883-33-5 |
English Synonyms: | WIN 46834 |
MDL Number.: | MFCD09837716 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | C[C@]12Cc3cnn(c3C=C1CC[C@H]4C2=CCC5(O4)C(=O)NC(=O)NC5=O)c6ccccc6 |
InChi: | InChI=1S/C24H22N4O4/c1-23-12-14-13-25-28(16-5-3-2-4-6-16)18(14)11-15(23)7-8-19-17(23)9-10-24(32-19)20(29)26-22(31)27-21(24)30/h2-6,9,11,13,19H,7-8,10,12H2,1H3,(H2,26,27,29,30,31)/t19-,23-/m0/s1 |
InChiKey: | InChIKey=AESWDEXOWUESBF-CVDCTZTESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.