* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | QUINABEN |
| CAS: | 101388-47-0 |
| English Synonyms: | QUINABEN |
| MDL Number.: | MFCD09837726 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | c1ccc2c(c1)c(=O)n(cn2)CCOC(=O)c3ccccc3c4[nH]c5ccccc5n4 |
| InChi: | InChI=1S/C24H18N4O3/c29-23-18-9-3-4-10-19(18)25-15-28(23)13-14-31-24(30)17-8-2-1-7-16(17)22-26-20-11-5-6-12-21(20)27-22/h1-12,15H,13-14H2,(H,26,27) |
| InChiKey: | InChIKey=QGMSIUUOBHXBKL-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.